4989-37-1 Usage
Uses
Used in Organic Synthesis:
[p-(Phenylazo)phenyl]thiourea is used as a reagent in organic synthesis for its capacity to form complex compounds with metal ions, facilitating various chemical reactions and contributing to the synthesis of new compounds.
Used in Dye Industry:
As a dye intermediate, [p-(Phenylazo)phenyl]thiourea plays a crucial role in the production of different types of dyes, capitalizing on its yellow-orange crystalline solid properties to create a range of color variations.
Used in Corrosion Inhibition:
[p-(Phenylazo)phenyl]thiourea is employed as a corrosion inhibitor, leveraging its metal-ion complexing ability to protect materials from degradation, particularly in the automotive and aerospace industries where metal protection is paramount.
Used as a Catalyst:
In the field of catalysis, [p-(Phenylazo)phenyl]thiourea is used to accelerate chemical reactions, enhancing efficiency and reducing the time required for processes to reach completion.
Used in Medicinal Chemistry:
[p-(Phenylazo)phenyl]thiourea is of interest for its potential pharmaceutical and biological activities, making it a subject of ongoing research. Its unique properties and ability to interact with metal ions make it a promising candidate for the development of new drugs and therapies.
Overall, [p-(Phenylazo)phenyl]thiourea is a multifaceted compound with applications spanning across organic synthesis, dye production, corrosion inhibition, catalysis, and medicinal chemistry, showcasing its significance in both industrial and scientific domains.
Check Digit Verification of cas no
The CAS Registry Mumber 4989-37-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,9,8 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4989-37:
(6*4)+(5*9)+(4*8)+(3*9)+(2*3)+(1*7)=141
141 % 10 = 1
So 4989-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N4S/c14-13(18)15-10-6-8-12(9-7-10)17-16-11-4-2-1-3-5-11/h1-9H,(H3,14,15,18)/b17-16+
