499240-48-1 Usage
General Description
2-(Piperidin-4-yloxy)pyrimidine is a chemical compound with the molecular formula C10H14N4O. It consists of a pyrimidine ring, which is a heterocyclic organic compound, bonded to a piperidin-4-yloxy group. 2-(Piperidin-4-yloxy)pyrimidine has been studied for its potential pharmaceutical applications, particularly for its use in medicinal chemistry and drug discovery. The piperidin-4-yloxy group is known to have biological activity and is often incorporated into drug molecules to enhance their pharmacological properties. Additionally, the pyrimidine ring is a common structural motif found in many pharmaceutical drugs, making 2-(Piperidin-4-yloxy)pyrimidine a valuable building block for drug development. Overall, this compound has the potential to be utilized in the synthesis of novel pharmaceutical agents with diverse therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 499240-48-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,9,9,2,4 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 499240-48:
(8*4)+(7*9)+(6*9)+(5*2)+(4*4)+(3*0)+(2*4)+(1*8)=191
191 % 10 = 1
So 499240-48-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H13N3O/c1-4-11-9(12-5-1)13-8-2-6-10-7-3-8/h1,4-5,8,10H,2-3,6-7H2
