499770-95-5 Usage
General Description
7-Bromo-4H-1,3-benzodioxine is a chemical compound with the molecular formula C8H5BrO2. It is a brominated derivative of 1,3-benzodioxine, which is a bicyclic heterocyclic compound. 7-Bromo-4H-1,3-benzodioxine is used in organic synthesis and pharmaceutical research as a building block and intermediate in the production of various pharmaceuticals and other organic compounds. It is known for its diverse applications in the field of medicinal chemistry and has potential uses in the development of new drugs and therapeutic agents. Additionally, it possesses interesting structural and physical properties that make it a valuable target for chemical investigation and academic research.
Check Digit Verification of cas no
The CAS Registry Mumber 499770-95-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,9,9,7,7 and 0 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 499770-95:
(8*4)+(7*9)+(6*9)+(5*7)+(4*7)+(3*0)+(2*9)+(1*5)=235
235 % 10 = 5
So 499770-95-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrO2/c9-7-2-1-6-4-10-5-11-8(6)3-7/h1-3H,4-5H2