499770-96-6 Usage
Description
6-(Bromomethyl)-3,4-dihydro-2H-1,5-benzodioxepine is an organic compound characterized by its unique chemical structure, which features a benzodioxepine ring system with a bromomethyl group at the 6th position. 6-(BROMOMETHYL)-3,4-DIHYDRO-2H-1,5-BENZODIOXEPINE is known for its potential applications in the pharmaceutical and chemical industries due to its versatile chemical properties.
Uses
Used in Pharmaceutical Industry:
6-(Bromomethyl)-3,4-dihydro-2H-1,5-benzodioxepine is used as a key intermediate compound for the synthesis of benzylindazole derivatives. These derivatives have been identified as potential Bub1 kinase inhibitors, which play a crucial role in various cellular processes, including cell cycle regulation and mitotic progression. Inhibition of Bub1 kinase has been linked to the treatment of certain types of cancer, making this compound a valuable asset in the development of novel therapeutic agents.
Used in Chemical Synthesis:
In addition to its pharmaceutical applications, 6-(Bromomethyl)-3,4-dihydro-2H-1,5-benzodioxepine can also be utilized in various chemical synthesis processes. Its unique structure and functional groups make it a versatile building block for the creation of a wide range of chemical compounds, including those with potential applications in materials science, agrochemicals, and other specialty chemical markets.
Check Digit Verification of cas no
The CAS Registry Mumber 499770-96-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,9,9,7,7 and 0 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 499770-96:
(8*4)+(7*9)+(6*9)+(5*7)+(4*7)+(3*0)+(2*9)+(1*6)=236
236 % 10 = 6
So 499770-96-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BrO2/c11-7-8-3-1-4-9-10(8)13-6-2-5-12-9/h1,3-4H,2,5-7H2
C:Corrosive;
