499770-97-7

Usage

Uses

Used in Pharmaceutical Industry:
1,3,4-Thiadiazole-2-carboxylic acid, 97% is used as a building block for the synthesis of various pharmaceuticals due to its unique chemical structure and potential biological activities, including antibacterial, antifungal, and antitumor properties. Its incorporation into drug molecules can enhance their therapeutic effects and target specific diseases.
Used in Agrochemical Industry:
In the agrochemical industry, 1,3,4-thiadiazole-2-carboxylic acid, 97% is utilized as a key component in the development of pesticides and other agrochemical products. Its biological activities can help protect crops from various pathogens and pests, thereby increasing agricultural productivity.
Used in Material Science:
1,3,4-Thiadiazole-2-carboxylic acid, 97% is employed in the development of advanced materials, such as organic electronic materials, due to its unique chemical and physical properties. Its integration into these materials can improve their performance and expand their potential applications in various fields.
Used in Corrosion Inhibition:
In various industrial applications, 1,3,4-thiadiazole-2-carboxylic acid, 97% is used as a corrosion inhibitor. Its ability to protect metal surfaces from corrosion extends the lifespan of equipment and reduces maintenance costs, making it a valuable asset in industries such as oil and gas, automotive, and aerospace.
Overall, 1,3,4-thiadiazole-2-carboxylic acid, 97% is a versatile and important chemical compound with a wide range of applications across different industries, from healthcare to material science and industrial applications. Its unique properties and potential for further research and development make it a promising candidate for future innovations.

InChI:InChI=1/C3H2N2O2S/c6-3(7)2-5-4-1-8-2/h1H,(H,6,7)