499770-99-9

Usage

Uses

Used in Pharmaceutical Industry:
1-Methyl-1H-imidazol-5-yl isocyanate is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to form stable and bioactive compounds. Its reactivity allows for the creation of new drug molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 1-Methyl-1H-imidazol-5-yl isocyanate is used as a precursor in the development of pesticides and other crop protection agents. Its reactive nature enables the formation of effective compounds that can protect crops from pests and diseases.
Used in Chemical Manufacturing:
1-Methyl-1H-imidazol-5-yl isocyanate is utilized in the production of various chemicals, taking advantage of its reactivity to form new compounds with specific properties. This contributes to the diversification of chemical products available for different applications.
Used as a Reagent in Organic Synthesis:
As a reagent, 1-Methyl-1H-imidazol-5-yl isocyanate is employed in organic synthesis processes to facilitate specific chemical reactions. Its high reactivity makes it a valuable tool for creating a wide range of organic compounds.
Used in Polyurethane Foam Production:
In the manufacturing of polyurethane foams, 1-Methyl-1H-imidazol-5-yl isocyanate serves as a crucial component. It contributes to the formation of the foam's structure, affecting its properties such as flexibility, durability, and insulation capabilities.
Safety Precautions:
Due to the high toxicity of 1-Methyl-1H-imidazol-5-yl isocyanate, it is essential to handle 1-Methyl-1H-imidazol-5-yl isocyanate with extreme caution. Proper safety measures include the use of protective equipment such as gloves, goggles, and respirators, as well as ensuring good ventilation in the workspace to minimize exposure to its harmful effects.

InChI:InChI=1/C5H5N3O/c1-8-3-6-2-5(8)7-4-9/h2-3H,1H3