499771-07-2 Usage
Uses
Used in Pharmaceutical Industry:
1-Benzyl-4-(3-nitropyridin-2-yl)piperazine is used as a potential therapeutic agent for various psychiatric disorders due to its structural similarity to other psychoactive compounds. Its potential applications include serving as an antidepressant, antipsychotic, or anxiolytic agent, which could be beneficial for the treatment of mood and mental health conditions.
Additionally, due to the bioisosteric properties of the nitropyridine group, 1-Benzyl-4-(3-nitropyridin-2-yl)piperazine may also be utilized in drug design as a substitute for other functional groups, potentially leading to the development of new pharmaceuticals with improved efficacy or reduced side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 499771-07-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,9,9,7,7 and 1 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 499771-07:
(8*4)+(7*9)+(6*9)+(5*7)+(4*7)+(3*1)+(2*0)+(1*7)=222
222 % 10 = 2
So 499771-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H18N4O2/c21-20(22)15-7-4-8-17-16(15)19-11-9-18(10-12-19)13-14-5-2-1-3-6-14/h1-8H,9-13H2
C:Corrosive;
