499771-09-4 Usage
General Description
METHYL 3-AMINO-4-CYANO-5-PIPERIDINOTHIOPHENE-2-CARBOXYLATE is a complex chemical compound with a molecular formula of C14H17N3O2S. It belongs to the class of organic compounds known as piperidines. This chemical is primarily used in pharmaceutical research and development, particularly in the synthesis of potential anti-inflammatory, anti-cancer, and anti-viral drugs. Its unique molecular structure and functional groups make it a valuable building block for the creation of new medicines and therapeutic agents. However, due to its complex nature and potential for medicinal applications, it requires careful handling and proper storage to ensure its stability and effectiveness in drug development processes.
Check Digit Verification of cas no
The CAS Registry Mumber 499771-09-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,9,9,7,7 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 499771-09:
(8*4)+(7*9)+(6*9)+(5*7)+(4*7)+(3*1)+(2*0)+(1*9)=224
224 % 10 = 4
So 499771-09-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3O2S/c1-17-12(16)10-9(14)8(7-13)11(18-10)15-5-3-2-4-6-15/h2-6,14H2,1H3