500148-38-9 Usage
Uses
Used in Pharmaceutical Industry:
4-Pyridinecarboxaldehyde, 5-fluoro-1,2-dihydro-2-oxo(9CI) is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its presence in the molecule can contribute to the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
4-Pyridinecarboxaldehyde, 5-fluoro-1,2-dihydro-2-oxo(9CI) is used as a building block in the construction of complex organic molecules. Its functional groups enable a multitude of reactions, making it a valuable component in the synthesis of a wide range of chemical products.
Used in Chemical Reactions:
4-Pyridinecarboxaldehyde, 5-fluoro-1,2-dihydro-2-oxo(9CI) is used as a reactant in various chemical reactions, allowing for the formation of new compounds with different properties and applications. Its versatility in reacting with other molecules makes it an important player in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 500148-38-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,0,1,4 and 8 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 500148-38:
(8*5)+(7*0)+(6*0)+(5*1)+(4*4)+(3*8)+(2*3)+(1*8)=99
99 % 10 = 9
So 500148-38-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H4FNO2/c7-5-2-8-6(10)1-4(5)3-9/h1-3H,(H,8,10)
