5007-32-9 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
1-Amino-2-phenylcyclopentanecarboxylic acid serves as a chiral building block, playing a crucial role in the synthesis of various pharmaceuticals and agrochemicals. Its ability to impart chirality to the molecules in which it is incorporated is vital for the development of enantiomerically pure compounds, which are essential in drug discovery and design.
Used in Peptide Synthesis:
Phenylglycine is utilized in the production of peptides, which are short chains of amino acids linked by peptide bonds. These peptides have a wide range of applications, including therapeutic uses, as they can be engineered to target specific biological processes or receptors.
Used in Organic Compound Production:
1-Amino-2-phenylcyclopentanecarboxylic acid is also employed in the preparation of amino acid derivatives, which are essential components in the synthesis of a variety of organic compounds. These derivatives can be used to create molecules with specific properties tailored for particular applications.
Used as a Catalyst in Organic Reactions:
Phenylglycine's unique structure allows it to act as a catalyst in certain organic reactions. Catalysts are substances that increase the rate of a chemical reaction without being consumed in the process, making them invaluable in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 5007-32-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,0 and 7 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5007-32:
(6*5)+(5*0)+(4*0)+(3*7)+(2*3)+(1*2)=59
59 % 10 = 9
So 5007-32-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2/c13-12(11(14)15)8-4-7-10(12)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,13H2,(H,14,15)
