501-13-3 Usage
Uses
Used in Plant Biology and Agriculture:
Feruloylputrescine is used as a signaling molecule for the development of nutrient-gathering root systems in plants. The inhibition of its formation leads to the development of a dominant or 'tap' root, which can have significant implications for plant growth and nutrient absorption.
Used in Chemical Research:
Feruloylputrescine serves as a subject for chemical research due to its unique properties and reactions. Its hygroscopic nature, wide temperature range for crystalline salt formation, and various chemical transformations make it an interesting compound for study in the fields of chemistry and material science.
Used in Pharmaceutical Applications:
Although not explicitly mentioned in the provided materials, the structure and properties of Feruloylputrescine may suggest potential pharmaceutical applications. Its ability to form various derivatives and undergo chemical reactions could make it a candidate for the development of new drugs or drug delivery systems. Further research would be required to explore these possibilities.
References
Ryabinin, Il'na., Dokl. Akad. Nauk SSSR, 67, 513 (1949)
Check Digit Verification of cas no
The CAS Registry Mumber 501-13-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,0 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 501-13:
(5*5)+(4*0)+(3*1)+(2*1)+(1*3)=33
33 % 10 = 3
So 501-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2O3/c1-19-13-10-11(4-6-12(13)17)5-7-14(18)16-9-3-2-8-15/h4-7,10,17H,2-3,8-9,15H2,1H3,(H,16,18)/b7-5+