501921-30-8 Usage
Description
(3aS,6aR)-Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one is a tetrahydrofuran derivative with the molecular formula C7H10O3, featuring a methoxy group attached to the furofuran ring. This chemical compound serves as a versatile building block in organic chemistry and exhibits potential biological activities, making it a promising candidate for pharmacological applications.
Uses
Used in Organic Chemistry:
(3aS,6aR)-Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one is used as a building block for the synthesis of more complex molecules, contributing to the development of novel chemical entities with diverse applications.
Used in Pharmaceutical Industry:
(3aS,6aR)-Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one is utilized as a key intermediate in the production of various drugs, playing a crucial role in the synthesis of pharmaceutical compounds with therapeutic potential.
Used in Drug Discovery and Development:
(3aS,6aR)-Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one is being studied for its potential biological activities, with the aim of identifying its pharmacological properties and exploring its use as a therapeutic agent in various medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 501921-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,1,9,2 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 501921-30:
(8*5)+(7*0)+(6*1)+(5*9)+(4*2)+(3*1)+(2*3)+(1*0)=108
108 % 10 = 8
So 501921-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O4/c1-9-7-4-2-6(8)11-5(4)3-10-7/h4-5,7H,2-3H2,1H3
