502145-07-5 Usage
Structure
A derivative of dithiolane, a five-membered heterocyclic compound containing two sulfur atoms and one nitrogen atom.
Acetylamino group
An amine group (-NH2) bonded to an acetyl group (-COCH3)
Carboxylic acid group
A -COOH group
Pharmaceutical synthesis
Used as a building block for various organic molecules in the pharmaceutical industry.
Agrochemical synthesis
Utilized in the synthesis of agrochemicals.
Antimicrobial
Exhibits antimicrobial properties in preliminary studies.
Anti-inflammatory
Shows potential anti-inflammatory properties in preliminary studies.
Versatility
The acetylamino group on the dithiolane ring makes it a valuable starting material for the production of various organic compounds, making it a useful and versatile chemical in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 502145-07-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,2,1,4 and 5 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 502145-07:
(8*5)+(7*0)+(6*2)+(5*1)+(4*4)+(3*5)+(2*0)+(1*7)=95
95 % 10 = 5
So 502145-07-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO3S2/c1-4(8)7-6(5(9)10)2-11-12-3-6/h2-3H2,1H3,(H,7,8)(H,9,10)
