502481-30-3 Usage
Uses
Used in Pharmaceutical Industry:
3,5-DINITRO-L-TYROSINE SODIUM SALT is used as a key intermediate in the synthesis of thyroid hormones, their salts, and derivatives. These hormones play a crucial role in regulating metabolism, growth, and development in the human body. 3,5-DINITRO-L-TYROSINE SODIUM SALT contributes to the development of medications that can help treat thyroid-related disorders.
Used in Chemical Industry:
In the chemical industry, 3,5-DINITRO-L-TYROSINE SODIUM SALT can be utilized as a building block for the synthesis of various organic compounds, including those with potential applications in the development of new drugs, agrochemicals, and other specialty chemicals. Its unique structural features make it a valuable component in the design and synthesis of novel molecules with specific properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 502481-30-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,2,4,8 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 502481-30:
(8*5)+(7*0)+(6*2)+(5*4)+(4*8)+(3*1)+(2*3)+(1*0)=113
113 % 10 = 3
So 502481-30-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O7.Na/c10-5(9(14)15)1-4-2-6(11(16)17)8(13)7(3-4)12(18)19;/h2-3,5,13H,1,10H2,(H,14,15);/q;+1/p-1/t5-;/m0./s1
