502509-05-9 Usage
General Description
2-Cyano-4-pyridine acetic acid is a chemical compound with the molecular formula C7H5NO2. It is a yellow crystalline powder that is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 2-CYANO-4-PYRIDINE ACETIC ACID is known for its anti-inflammatory and analgesic properties, making it a valuable component in the development of drugs for various medical conditions. It is also used in the production of pesticides and herbicides. Additionally, 2-cyano-4-pyridine acetic acid is utilized in the manufacturing of dyes, pigments, and other industrial products due to its versatile chemical properties. Overall, this chemical compound plays a crucial role in the pharmaceutical and agricultural industries, making it a valuable commodity in the field of chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 502509-05-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,2,5,0 and 9 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 502509-05:
(8*5)+(7*0)+(6*2)+(5*5)+(4*0)+(3*9)+(2*0)+(1*5)=109
109 % 10 = 9
So 502509-05-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O2/c9-5-7-3-6(1-2-10-7)4-8(11)12/h1-3H,4H2,(H,11,12)
