502685-45-2 Usage
Uses
Used in Pharmaceutical Industry:
5-(2-Methylbenzyl)-4H-1,2,4-triazol-3-amine is used as a key intermediate in the synthesis of various pharmaceuticals for its potential biological activities. Its unique structure allows for the development of new drugs and therapeutic agents that can target specific biological pathways or receptors.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 5-(2-Methylbenzyl)-4H-1,2,4-triazol-3-amine serves as a valuable research compound. It is employed in the design and synthesis of novel drug candidates, enabling scientists to explore its potential applications in treating various diseases and conditions.
Used in Drug Development:
5-(2-Methylbenzyl)-4H-1,2,4-triazol-3-amine is utilized in the development of new drugs and therapeutic agents due to its potential biological activities. Its unique chemical structure allows for the creation of compounds with specific pharmacological properties, making it a promising candidate for drug discovery and development.
Used in Chemical Synthesis:
As a triazole derivative with a 2-methylbenzyl substituent, 5-(2-Methylbenzyl)-4H-1,2,4-triazol-3-amine is employed in various chemical synthesis processes. Its versatile structure allows for the formation of a wide range of compounds with different functional groups and properties, making it a valuable building block in organic synthesis.
Used in Safety and Hazard Assessment:
Due to the potential hazards associated with 5-(2-Methylbenzyl)-4H-1,2,4-triazol-3-amine, it is essential to conduct safety and hazard assessments during its handling, synthesis, and application. This ensures the protection of researchers, workers, and the environment from potential risks associated with this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 502685-45-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,2,6,8 and 5 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 502685-45:
(8*5)+(7*0)+(6*2)+(5*6)+(4*8)+(3*5)+(2*4)+(1*5)=142
142 % 10 = 2
So 502685-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N4/c1-7-4-2-3-5-8(7)6-9-12-10(11)14-13-9/h2-5H,6H2,1H3,(H3,11,12,13,14)
