502685-85-0 Usage
Uses
Used in Pharmaceutical Industry:
5-(4-Methylbenzyl)-4H-1,2,4-triazol-3-amine is used as a building block for the synthesis of biologically active molecules for the development of new drugs and medicines. Its unique structure and properties allow it to be incorporated into various drug candidates, potentially enhancing their efficacy and selectivity.
Used in Research Applications:
5-(4-Methylbenzyl)-4H-1,2,4-triazol-3-amine is used as a ligand in research to investigate its interactions with various biological targets. This can provide valuable insights into the compound's potential therapeutic applications and help guide the design of new drugs with improved properties.
Used in Drug Discovery:
5-(4-Methylbenzyl)-4H-1,2,4-triazol-3-amine is used in drug discovery as a starting point for the development of new chemical entities. Its unique structure and properties make it a promising candidate for further optimization and modification to create novel therapeutic agents.
Used in Medicinal Chemistry:
5-(4-Methylbenzyl)-4H-1,2,4-triazol-3-amine is used in medicinal chemistry to explore its potential as a lead compound for the treatment of various diseases. Its chemical and biological properties can be further optimized to improve its pharmacokinetic and pharmacodynamic profiles, making it a valuable asset in the development of new therapeutic agents.
Used in Chemical Synthesis:
5-(4-Methylbenzyl)-4H-1,2,4-triazol-3-amine is used as a key intermediate in the synthesis of various chemical compounds. Its unique structure allows for the formation of diverse chemical entities, making it a versatile building block in the development of new materials and compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 502685-85-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,2,6,8 and 5 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 502685-85:
(8*5)+(7*0)+(6*2)+(5*6)+(4*8)+(3*5)+(2*8)+(1*5)=150
150 % 10 = 0
So 502685-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N4/c1-7-2-4-8(5-3-7)6-9-12-10(11)14-13-9/h2-5H,6H2,1H3,(H3,11,12,13,14)
502685-85-0Relevant academic research and scientific papers
A structure-activity relationship study of 1,2,4-triazolo[1,5-a][1,3,5] triazin-5,7-dione and its 5-thioxo analogues on anti-thymidine phosphorylase and associated anti-angiogenic activities
Bera, Hriday,Tan, Bee Jen,Sun, Lingyi,Dolzhenko, Anton V.,Chui, Wai-Keung,Chiu, Gigi Nagar Chee
, p. 325 - 334 (2013/10/01)
Thirty-three 1,2,4-triazolo[1,5-a][1,3,5]triazin-5,7-dione and its 5-thioxo analogues were designed and synthesized which contained different substituents at meta- and/or para-positions of 2-phenyl or 2-benzyl ring attached to the fused ring structure. Th
