50270-30-9 Usage
Uses
Used in Pharmaceutical Industry:
1-Benzyl-4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine is used as an anti-cancer agent for its potential to target and inhibit the growth of cancer cells. Its specific molecular structure allows it to interfere with essential cellular processes in cancer cells, thereby exhibiting anti-tumor activity.
Used in Inflammatory Disease Treatment:
In the field of inflammatory disease treatment, 1-Benzyl-4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine is utilized for its potential to modulate inflammatory responses. Its ability to inhibit specific protein kinases involved in inflammatory pathways makes it a candidate for the development of anti-inflammatory drugs.
Used in Antiviral Drug Development:
1-Benzyl-4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine is considered for use as an anti-viral agent due to its potential to interfere with viral replication and infection processes. Its unique chemical structure may enable it to target viral enzymes or proteins, thereby inhibiting viral activity and reducing the spread of infection.
Used in Synthesis of Pharmaceutical Compounds:
In the synthesis of pharmaceutical compounds, 1-Benzyl-4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine serves as a key intermediate or building block. Its versatile chemical properties allow it to be incorporated into the development of new drugs with various therapeutic targets and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 50270-30-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,2,7 and 0 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 50270-30:
(7*5)+(6*0)+(5*2)+(4*7)+(3*0)+(2*3)+(1*0)=79
79 % 10 = 9
So 50270-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H8Cl2N4/c13-10-9-6-15-18(11(9)17-12(14)16-10)7-8-4-2-1-3-5-8/h1-6H,7H2
50270-30-9Relevant academic research and scientific papers
ANTIVIRAL PYRIMIDINES
-
Page/Page column 92, (2010/11/03)
Disclosed herein are novel compounds comprising substituted pyrimidines, pyrazolopyrimtdines, and imidazolopyrimidines, the syntheses thereof, and compositions thereof, including pharmaceutical compositions, comprising the novel pyrimidines, pyrazolopyrimtdines, imidazolpyrimidines and related compounds. Such compounds function to inhibit entry of viruses of the Flaviviridae family, including Hepatitis C virus (HCV), into cells that are susceptible to virus infection. These compounds are useful for the treatment, therapy and/or prophylaxis of viral diseases and infection, including HCV infection.
Acetonitrile-mediated synthesis of 2,4-dichloroquinoline from 2-ethynylaniline and 2,4-dichloroquinazoline from anthranilonitrile
Lee, Jae Hak,Lee, Byoung Se,Shin, Hyunik,Nam, Do Hyun,Chi, Dae Yoon
, p. 65 - 68 (2007/10/03)
2,4-Dichloroquinolines and 2,4-dichloroquinazolines were synthesized from 2-ethynylanilines and anthranilonitriles, respectively, using diphosgene in acetonitrile and heating at 130 °C or 150 °C for 12 hours. This reaction was applied to the synthesis of 4,6-dichloropyrazolo[3,4-d]pyrimidine (dichloro-9H-isopurine). The postulated mechanism is also described. Georg Thieme Verlag Stuttgart.
