50283-78-8 Usage
General Description
The chemical "1-[[2-(Diethylamino)ethyl]amino]-4-(hydroxymethyl)-9H-thioxanthen-9-one=2-furancarboxylate" is a thioxanthene derivative that has a complex molecular structure. It contains an ethylaminoethylamino group and a furancarboxylate group, along with a hydroxymethyl and thioxanthene moieties. Thioxanthene derivatives are known for their antipsychotic properties and are used in the treatment of schizophrenia and other mental disorders. The specific chemical properties and potential uses of this compound would require further investigation and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 50283-78-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,2,8 and 3 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 50283-78:
(7*5)+(6*0)+(5*2)+(4*8)+(3*3)+(2*7)+(1*8)=108
108 % 10 = 8
So 50283-78-8 is a valid CAS Registry Number.
InChI:InChI=1/C25H26N2O4S/c1-3-27(4-2)14-13-26-19-12-11-17(16-31-25(29)20-9-7-15-30-20)24-22(19)23(28)18-8-5-6-10-21(18)32-24/h5-12,15,26H,3-4,13-14,16H2,1-2H3