503293-47-8 Usage
Uses
Used in Pharmaceutical Industry:
6-CHLORO-2-FLUOROBENZOTETRAZOLE is used as a building block for the synthesis of biologically active compounds, such as antivirals and antibacterial agents, due to its strong reactivity and versatile chemical properties.
Used in Agrochemical Industry:
6-CHLORO-2-FLUOROBENZOTETRAZOLE is used as a key intermediate in the development of agrochemical products, contributing to the creation of effective and innovative solutions for agricultural applications.
Used in Organic Synthesis:
6-CHLORO-2-FLUOROBENZOTETRAZOLE is used as a versatile intermediate in organic synthesis, enabling the formation of a wide range of chemical compounds with potential applications in various fields.
Used in Coordination Chemistry:
6-CHLORO-2-FLUOROBENZOTETRAZOLE is used as a ligand in coordination chemistry, playing a crucial role in the formation of metal complexes with unique properties and potential applications.
Used in Electrochemical and Photochemical Reactions:
6-CHLORO-2-FLUOROBENZOTETRAZOLE is used as a substrate in electrochemical and photochemical reactions, providing opportunities for the development of novel materials and processes with potential applications in energy, sensing, and other areas.
Check Digit Verification of cas no
The CAS Registry Mumber 503293-47-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,3,2,9 and 3 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 503293-47:
(8*5)+(7*0)+(6*3)+(5*2)+(4*9)+(3*3)+(2*4)+(1*7)=128
128 % 10 = 8
So 503293-47-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClFN4/c8-4-2-1-3-5(9)6(4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13)
