503417-29-6 Usage
General Description
Cyclopropanamine, 1-(2-methylphenyl)- (9CI) is a chemical compound that belongs to the class of cycloalkanes, specifically cyclopropanes. It is also known as 2-methylphenylcyclopropylamine and has a molecular formula of C10H13N. Cyclopropanamine, 1-(2-methylphenyl)- (9CI) is used in the synthesis and production of various pharmaceuticals and agrochemicals. Its structure consists of a cyclopropane ring attached to a phenyl group, which gives it unique molecular and chemical properties. It is also known to exhibit certain biological activities and may have potential applications in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 503417-29-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,3,4,1 and 7 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 503417-29:
(8*5)+(7*0)+(6*3)+(5*4)+(4*1)+(3*7)+(2*2)+(1*9)=116
116 % 10 = 6
So 503417-29-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N/c1-8-4-2-3-5-9(8)10(11)6-7-10/h2-5H,6-7,11H2,1H3
