503417-38-7 Usage
Uses
Used in Pharmaceutical Industry:
1-Pyridin-3-yl-cyclopropylamine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, which combines the basic amine group with the aromatic pyridine ring, allows it to be a versatile building block in the development of new drugs.
Used in Agrochemicals:
1-Pyridin-3-yl-cyclopropylamine is used as a key component in the formulation of agrochemicals, such as pesticides and herbicides. Its chemical properties make it suitable for creating effective and targeted agrochemical products.
Used in Natural Products:
1-Pyridin-3-yl-cyclopropylamine is used as a constituent in the synthesis of natural products, where its unique chemical structure can contribute to the development of novel bioactive compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 503417-38-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,3,4,1 and 7 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 503417-38:
(8*5)+(7*0)+(6*3)+(5*4)+(4*1)+(3*7)+(2*3)+(1*8)=117
117 % 10 = 7
So 503417-38-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2/c9-8(3-4-8)7-2-1-5-10-6-7/h1-2,5-6H,3-4,9H2
