50476-72-7 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate is used as a potential drug candidate for the development of new medications due to its unique structural features and possible biological activities. Its specific applications and efficacy, however, require further research to fully understand its properties and potential uses in drug discovery and therapeutic interventions.
Check Digit Verification of cas no
The CAS Registry Mumber 50476-72-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,4,7 and 6 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 50476-72:
(7*5)+(6*0)+(5*4)+(4*7)+(3*6)+(2*7)+(1*2)=117
117 % 10 = 7
So 50476-72-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClN3O2/c1-2-15-9(14)6-3-11-8-5(7(6)10)4-12-13-8/h3-4H,2H2,1H3,(H,11,12,13)
