5049-49-0 Usage
Uses
Used in Organic Synthesis:
1-(2-FURYLMETHYL)-2,5-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE is used as a building block in organic synthesis for creating diverse molecules. Its unique structure allows for the formation of new compounds with potential applications across various industries.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(2-FURYLMETHYL)-2,5-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE is utilized as a key component in the development of new pharmaceuticals. Its potential biological activity makes it a valuable candidate for drug discovery, where it can be incorporated into molecules with therapeutic properties.
Used in Drug Discovery and Development:
Due to its unique structure and potential biological activity, 1-(2-FURYLMETHYL)-2,5-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE is used in drug discovery and development. Researchers explore its properties to create new drugs with various therapeutic effects.
Used in Flavor and Fragrance Production:
1-(2-FURYLMETHYL)-2,5-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE is also used in the production of flavors and fragrances. Its aromatic nature makes it a suitable candidate for creating unique scents and tastes in the perfumery and food industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5049-49-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,4 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5049-49:
(6*5)+(5*0)+(4*4)+(3*9)+(2*4)+(1*9)=90
90 % 10 = 0
So 5049-49-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO2/c1-9-6-11(8-14)10(2)13(9)7-12-4-3-5-15-12/h3-6,8H,7H2,1-2H3
