50610-34-9 Usage
General Description
Glycinecarbonatesodiumsalt is a chemical compound formed from the combination of glycine, carbonate, and sodium. It is often used as a buffering agent in various pharmaceutical and cosmetic products. As a salt of glycine, it helps stabilize the pH of solutions and can also act as a mild cleanser and skin conditioning agent. Additionally, glycinecarbonatesodiumsalt has been studied for its potential use in dental applications due to its ability to inhibit the formation of dental plaque. Overall, this compound plays a crucial role in various industries, including healthcare, personal care, and oral hygiene.
Check Digit Verification of cas no
The CAS Registry Mumber 50610-34-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,6,1 and 0 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 50610-34:
(7*5)+(6*0)+(5*6)+(4*1)+(3*0)+(2*3)+(1*4)=79
79 % 10 = 9
So 50610-34-9 is a valid CAS Registry Number.
InChI:InChI=1/C2H5NO2.CH2O3.3Na/c3-1-2(4)5;2-1(3)4;;;/h1,3H2,(H,4,5);(H2,2,3,4);;;/q;;3*+1/p-3