50628-34-7 Usage
Uses
Used in Pharmaceutical Industry:
5-Pyrimidinecarboxylic acid, 1,2-dihydro-2-oxo-, methyl ester (9CI) is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications, contributing to the advancement of medicine and healthcare.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Pyrimidinecarboxylic acid, 1,2-dihydro-2-oxo-, methyl ester (9CI) is utilized as a building block in the creation of agrochemicals. Its incorporation into these compounds can enhance crop protection and yield, supporting sustainable agriculture and food security.
Used in Organic Chemistry Research:
As a versatile chemical compound, 5-Pyrimidinecarboxylic acid, 1,2-dihydro-2-oxo-, methyl ester (9CI) is employed in organic chemistry research for the exploration of new synthetic pathways and the development of innovative materials. Its unique properties make it a valuable tool for scientists in the field.
Used in Material Science:
5-Pyrimidinecarboxylic acid, 1,2-dihydro-2-oxo-, methyl ester (9CI) may also have potential applications in material science, where it could be used to develop new materials with unique properties. Its integration into various materials could lead to advancements in industries such as electronics, textiles, and coatings.
It is important to handle 5-Pyrimidinecarboxylic acid, 1,2-dihydro-2-oxo-, methyl ester (9CI) with care, as it may have potential health and safety hazards associated with its use. Proper safety measures should be taken to minimize risks during its production, storage, and application.
Check Digit Verification of cas no
The CAS Registry Mumber 50628-34-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,6,2 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 50628-34:
(7*5)+(6*0)+(5*6)+(4*2)+(3*8)+(2*3)+(1*4)=107
107 % 10 = 7
So 50628-34-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3/c1-11-5(9)4-2-7-6(10)8-3-4/h2-3H,1H3,(H,7,8,10)
