50740-38-0 Usage
General Description
[(2-ethylphenyl)amino](oxo)acetic acid is a chemical compound with the molecular formula C10H13NO3. It is a derivative of acetic acid, with an amino group attached to a phenyl ring, and a carbonyl group attached to the alpha carbon. The compound has potential applications in pharmaceuticals, as it can act as a building block for the synthesis of various drug molecules. It is also used in research and chemical synthesis as a reagent for the preparation of complex organic compounds. The presence of the phenyl and carbonyl groups gives [(2-ethylphenyl)amino](oxo)acetic acid unique chemical properties, making it useful in a range of chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 50740-38-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,7,4 and 0 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 50740-38:
(7*5)+(6*0)+(5*7)+(4*4)+(3*0)+(2*3)+(1*8)=100
100 % 10 = 0
So 50740-38-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO3/c1-2-7-5-3-4-6-8(7)11-9(12)10(13)14/h3-6H,2H2,1H3,(H,11,12)(H,13,14)
