50792-65-9 Usage
Uses
Used in Pharmaceutical Production:
Iron, 7,16-dihydrodibenzob,i1,4,8,11tetraazacyclotetradecinato(2-)-.kappa.N5,.kappa.N9,.kappa.N14,.kappa.N18-, (SP-4-1)is utilized as a chelating agent in the production of pharmaceuticals, where its ability to form stable complexes with metal ions is crucial for the development of drugs with enhanced stability and bioavailability.
Used as a Catalyst in Chemical Reactions:
In the realm of catalysis, Iron, 7,16-dihydrodibenzob,i1,4,8,11tetraazacyclotetradecinato(2-)-.kappa.N5,.kappa.N9,.kappa.N14,.kappa.N18-, (SP-4-1)- serves as a catalyst, leveraging its chelating properties to facilitate various chemical reactions. Its capacity to bind metal ions allows it to influence reaction rates and selectivity, making it a valuable asset in the synthesis of complex organic molecules.
Used as a Contrast Agent in MRI Imaging:
Iron, 7,16-dihydrodibenzob,i1,4,8,11tetraazacyclotetradecinato(2-)-.kappa.N5,.kappa.N9,.kappa.N14,.kappa.N18-, (SP-4-1)is also employed as a contrast agent in Magnetic Resonance Imaging (MRI). Its interaction with metal ions enhances the imaging capabilities, providing clearer visualization of internal structures and aiding in the diagnosis of various medical conditions.
Used in Environmental Remediation:
Iron, 7,16-dihydrodibenzob,i1,4,8,11tetraazacyclotetradecinato(2-)-.kappa.N5,.kappa.N9,.kappa.N14,.kappa.N18-, (SP-4-1)-'s chelating properties make it suitable for environmental applications, such as the removal of heavy metal ions from contaminated water sources. By binding to these ions, it can help in detoxifying polluted environments and contribute to ecological restoration efforts.
Used in the Electronics Industry:
In the electronics sector, Iron, 7,16-dihydrodibenzob,i1,4,8,11tetraazacyclotetradecinato(2-)-.kappa.N5,.kappa.N9,.kappa.N14,.kappa.N18-, (SP-4-1)may be used in the development of advanced materials with specific electronic properties, such as semiconductors or superconductors, where its ability to form coordination complexes with metal ions plays a pivotal role.
Check Digit Verification of cas no
The CAS Registry Mumber 50792-65-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,7,9 and 2 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 50792-65:
(7*5)+(6*0)+(5*7)+(4*9)+(3*2)+(2*6)+(1*5)=129
129 % 10 = 9
So 50792-65-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H14N4.Fe/c1-2-8-16-15(7-1)19-11-5-13-21-17-9-3-4-10-18(17)22-14-6-12-20-16;/h1-14H;/q-2;+2/b11-5-,14-6-,20-12+,21-13+;
50792-65-9Relevant academic research and scientific papers
Polymeric (Dihydrodibenzo-1,4,8,11-tetraazaannulene)iron(II) with Pyrazine Bridges
Koch, Juergen,Hanack, Michael
, p. 2109 - 2114 (2007/10/02)
5,14-Dihydrodibenzotetraazacyclotetradecin (H2taa) (3) and ferrous acetate reats in the presence of pyridine via the pyridine complex 4 to form Fetaa (5).If 5 is reacted with pyrazine under various conditions, the pyrazine bridged polymer 6 is formed as the only product.The instable monomer 7 could not be isolated.The polymer 6 shows a conductivity of 1 x 10-5 S x cm-1 at room temperature which is 107 times higher than that of 5.
