50798-38-4 Usage
Uses
Used in Pharmaceutical Industry:
2-(3-nitro-2-pyridinylamino)ethanol is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure, which includes a pyridine ring and a nitro-group, makes it a valuable component in the creation of new drug molecules, potentially leading to the development of novel therapeutic agents.
Used in Organic Chemistry Research:
2-(3-nitro-2-pyridinylamino)ethanol is used as a reagent in organic chemistry research, particularly for studying the reactions and properties of amines and their derivatives. Its presence in the synthesis of complex organic molecules can provide insights into the mechanisms of various chemical reactions and contribute to the advancement of organic chemistry knowledge.
Used in Material Science:
2-(3-nitro-2-pyridinylamino)ethanol is used as a building block in the development of new materials, such as polymers and composites, that may exhibit unique properties due to the incorporation of the pyridine ring and nitro-group. Its potential applications in material science could lead to the creation of innovative materials with applications in various industries, including electronics, aerospace, and automotive.
Check Digit Verification of cas no
The CAS Registry Mumber 50798-38-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,7,9 and 8 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 50798-38:
(7*5)+(6*0)+(5*7)+(4*9)+(3*8)+(2*3)+(1*8)=144
144 % 10 = 4
So 50798-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O3/c11-5-4-9-7-6(10(12)13)2-1-3-8-7/h1-3,11H,4-5H2,(H,8,9)
