50802-52-3 Usage
General Description
"4-N-PENTYLBENZOIC ACID 4'-N-HEXYLOXYPHENYL ESTER" is a chemical compound known by the CAS registry number 142674-42-0. 4-N-PENTYLBENZOIC ACID 4'-N-HEXYLOXYPHENYL ESTER belongs to the family of benzene and substituted derivatives, with its molecular structure containing a benzene ring linked to a pentyl group and a hexyloxyphenyl ester group. While specific information about its applications and properties aren't widely available, as an organic compound, it is likely involved in various industrial and scientific applications, including polymer synthesis, or pharmaceutical research. Further research is required to identify its physical and chemical properties, potential risks, or toxicity.
Check Digit Verification of cas no
The CAS Registry Mumber 50802-52-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,8,0 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 50802-52:
(7*5)+(6*0)+(5*8)+(4*0)+(3*2)+(2*5)+(1*2)=93
93 % 10 = 3
So 50802-52-3 is a valid CAS Registry Number.
InChI:InChI=1/C24H32O3/c1-3-5-7-9-19-26-22-15-17-23(18-16-22)27-24(25)21-13-11-20(12-14-21)10-8-6-4-2/h11-18H,3-10,19H2,1-2H3