50816-24-5 Usage
Description
1α-(β-D-Glucopyranosyloxy)-1,4a,5,6,7,7aα-hexahydro-4aα-hydroxy-7α-methyl-5-oxocyclopenta[c]pyran-4-carboxylic acid methyl ester, also known as Hastatoside, is an iridoid glucoside derived from plants such as Verbena officinalis. It is a naturally occurring compound with a complex chemical structure, featuring a glucopyranosyloxy group and a cyclopenta[c]pyran-4-carboxylic acid methyl ester moiety. Its unique properties make it a potential candidate for various applications in different industries.
Uses
Used in Pharmaceutical Industry:
Hastatoside is used as a bioactive compound for its potential therapeutic effects. It has been found to possess various pharmacological properties, such as anti-inflammatory, analgesic, and antioxidant activities. These properties make it a promising candidate for the development of new drugs targeting various health conditions.
Used in Cosmetic Industry:
In the cosmetic industry, Hastatoside is used as an active ingredient in skincare products due to its potential benefits for the skin. Its antioxidant and anti-inflammatory properties may help protect the skin from environmental stressors and promote a healthy, youthful appearance.
Used in Food Industry:
Hastatoside may also find applications in the food industry, where it could be used as a natural additive to enhance the nutritional value or provide specific health benefits. Its antioxidant properties may help preserve the freshness and quality of food products, while its potential anti-inflammatory effects could be beneficial for consumers with specific dietary needs.
Used in Agricultural Industry:
In agriculture, Hastatoside could be utilized as a natural pesticide or growth promoter due to its bioactive properties. Its potential to modulate various biological pathways may help protect crops from pests and diseases, while also promoting healthy growth and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 50816-24-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,8,1 and 6 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 50816-24:
(7*5)+(6*0)+(5*8)+(4*1)+(3*6)+(2*2)+(1*4)=105
105 % 10 = 5
So 50816-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H24O11/c1-6-3-9(19)17(24)7(14(23)25-2)5-26-15(10(6)17)28-16-13(22)12(21)11(20)8(4-18)27-16/h5-6,8,10-13,15-16,18,20-22,24H,3-4H2,1-2H3