50876-87-4 Usage
Uses
Used in Polymer Production:
(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is used as a crosslinking agent for enhancing the structural integrity and properties of polymers. Its ability to form covalent bonds between polymer chains results in improved mechanical strength, thermal stability, and chemical resistance in the final product.
Used in Chemical Reactions:
As a solvent, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene plays a crucial role in various chemical reactions. Its wide solubility range allows it to dissolve a broad spectrum of substances, facilitating reaction kinetics and ensuring a homogeneous reaction environment.
Used in Adhesives:
(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is used as a component in the formulation of adhesives, where its crosslinking properties contribute to the development of strong and durable bonds between different materials.
Used in Coatings:
In the coatings industry, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is utilized to improve the adhesion, flexibility, and durability of coating materials, providing a robust and long-lasting protective layer on various surfaces.
Used in Sealants:
(Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is also employed in the production of sealants, where its crosslinking ability helps create a tight, impermeable barrier that is resistant to environmental factors such as moisture, temperature fluctuations, and mechanical stress.
Overall, (Z)-1-(2,2-dimethoxyethoxy)hex-3-ene is a valuable chemical intermediate with a diverse range of applications across different industries, thanks to its unique structural features and functional properties.
Check Digit Verification of cas no
The CAS Registry Mumber 50876-87-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,8,7 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 50876-87:
(7*5)+(6*0)+(5*8)+(4*7)+(3*6)+(2*8)+(1*7)=144
144 % 10 = 4
So 50876-87-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H20O3/c1-4-5-6-7-8-13-9-10(11-2)12-3/h5-6,10H,4,7-9H2,1-3H3/b6-5+
