5090-67-5 Usage
Uses
Used in Pharmaceutical Industry:
(3aS,6aβ,9bβ)-3a,4,5,6,6a,7,8,9,9a,9b-Decahydro-8β,9β-dihydroxy-6α,9aα-dimethyl-3-methyleneazuleno[4,5-b]furan-2(3H)-one is used as a potential pharmaceutical compound for its unique chemical structure and properties. Its complex arrangement of carbon and oxygen atoms, along with the presence of hydroxyl and methylene groups, may offer novel therapeutic applications and opportunities for drug development.
Used in Research and Development:
(3aS,6aβ,9bβ)-3a,4,5,6,6a,7,8,9,9a,9b-Decahydro-8β,9β-dihydroxy-6α,9aα-dimethyl-3-methyleneazuleno[4,5-b]furan-2(3H)-one is used as a subject of research and development in various scientific fields. Its structural complexity and unique features make it an interesting candidate for further study and analysis, potentially leading to new discoveries and applications in chemistry, materials science, and other related disciplines.
Used in Industrial Applications:
(3aS,6aβ,9bβ)-3a,4,5,6,6a,7,8,9,9a,9b-Decahydro-8β,9β-dihydroxy-6α,9aα-dimethyl-3-methyleneazuleno[4,5-b]furan-2(3H)-one may also find use in various industrial applications due to its unique chemical properties. Its potential applications could include the development of new materials, catalysts, or other products that leverage the compound's structural features and reactivity. Further research and development are necessary to fully explore and understand the compound's potential in these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 5090-67-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,9 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5090-67:
(6*5)+(5*0)+(4*9)+(3*0)+(2*6)+(1*7)=85
85 % 10 = 5
So 5090-67-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O4/c1-7-4-5-9-8(2)14(18)19-13(9)15(3)10(7)6-11(16)12(15)17/h7,9-13,16-17H,2,4-6H2,1,3H3
