50917-30-1 Usage
Uses
Used in Pharmaceutical Industry:
Benzoic acid, 3-amino-4,5-dichloro(9CI) is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with enhanced therapeutic properties and targeted effects.
Used in Agrochemical Industry:
In the agrochemical industry, Benzoic acid, 3-amino-4,5-dichloro(9CI) serves as an essential building block for the creation of novel agrochemicals. Its potential antimicrobial and antifungal properties make it a promising candidate for the development of effective pesticides and fungicides to protect crops and enhance agricultural productivity.
Used in Antimicrobial Applications:
Due to its structural features, Benzoic acid, 3-amino-4,5-dichloro(9CI) exhibits antimicrobial properties, making it suitable for use in various applications where microbial control is necessary. It can be incorporated into formulations for disinfection, preservation, and hygiene purposes.
Used in Antifungal Applications:
Benzoic acid, 3-amino-4,5-dichloro(9CI) also demonstrates antifungal properties, which can be leveraged in the development of antifungal agents. It can be used in medical, veterinary, and agricultural settings to combat fungal infections and protect against fungal contamination.
It is crucial to handle Benzoic acid, 3-amino-4,5-dichloro(9CI) with care and adhere to proper safety protocols during its use to minimize any potential hazards associated with this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 50917-30-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,9,1 and 7 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 50917-30:
(7*5)+(6*0)+(5*9)+(4*1)+(3*7)+(2*3)+(1*0)=111
111 % 10 = 1
So 50917-30-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H5Cl2NO2/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,10H2,(H,11,12)
