51035-70-2 Usage
Uses
Used in Chemical Synthesis:
3-Pyridinemethanol,5-hydroxy-(9CI) is used as a chemical intermediate for the synthesis of various complex organic compounds. Its unique structure with both alcohol and amine properties allows it to participate in a wide range of chemical reactions, making it a valuable building block in the field of chemistry.
Used in Pharmaceutical Development:
3-Pyridinemethanol,5-hydroxy-(9CI) is used as a potential candidate for the development of new pharmaceuticals. Its functional groups can be exploited to create novel drug molecules with potential therapeutic applications. However, further research is needed to explore its safety, efficacy, and potential side effects.
Used in Research Applications:
3-Pyridinemethanol,5-hydroxy-(9CI) is used as a research tool in academic and industrial laboratories. Its unique structure and properties make it an interesting subject for studying various chemical and biological processes. Researchers can use 3-Pyridinemethanol,5-hydroxy-(9CI) to investigate its interactions with other molecules and its potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 51035-70-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,0,3 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 51035-70:
(7*5)+(6*1)+(5*0)+(4*3)+(3*5)+(2*7)+(1*0)=82
82 % 10 = 2
So 51035-70-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO2/c8-4-5-1-6(9)3-7-2-5/h1-3,8-9H,4H2
51035-70-2Relevant academic research and scientific papers
Synthetic routes to three novel scaffolds for potential glycosidase inhibitors
Rommel, Michael,Ernst, Alexander,Koert, Ulrich
, p. 4408 - 4430 (2008/09/17)
Efficient syntheses of three novel scaffolds for potential β-glycosidase inhibitors were developed: The first consists of a 2,7-dioxabicyclo[2.2.1]heptane derivative, which was prepared by an intramolecular ketalisation. The second scaffold consists of a
