51069-26-2 Usage
Description
Methyl quinuclidine-4-carboxylate is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and chemical compounds. It is characterized by its unique structure, which includes a quinuclidine ring and a carboxylate group, making it a versatile building block for the development of new drugs and materials.
Uses
Used in Pharmaceutical Industry:
Methyl quinuclidine-4-carboxylate is used as a reactant for the synthesis of oxadiazole and indolyloxadiazole 5-HT3 hydroxytryptamine (5-HT3) antagonists. These antagonists are important in the development of medications targeting the 5-HT3 receptor, which plays a crucial role in various physiological processes, including serotonin signaling and the regulation of nausea and vomiting.
In the synthesis of these antagonists, Methyl quinuclidine-4-carboxylate contributes to the formation of the core structure of the compounds, allowing for the attachment of various functional groups that can modulate the activity and selectivity of the final product. This makes it a valuable component in the design and production of novel therapeutic agents with potential applications in treating a range of conditions, such as chemotherapy-induced nausea and vomiting, irritable bowel syndrome, and other disorders related to serotonin signaling.
Check Digit Verification of cas no
The CAS Registry Mumber 51069-26-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,0,6 and 9 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 51069-26:
(7*5)+(6*1)+(5*0)+(4*6)+(3*9)+(2*2)+(1*6)=102
102 % 10 = 2
So 51069-26-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H15NO2/c1-12-8(11)9-2-5-10(6-3-9)7-4-9/h2-7H2,1H3
