5109-97-7 Usage
Uses
Used in Pharmaceutical Industry:
2-Pyridin-3-yl-quinoline-4-carboxylic acid hydrazide is used as a key intermediate in the synthesis of various pharmaceuticals for its potential antitumor and antiviral properties. It contributes to the development of new drugs targeting cancer and viral infections, offering therapeutic benefits through its unique chemical structure and bioactivity.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Pyridin-3-yl-quinoline-4-carboxylic acid hydrazide is utilized as a building block in the creation of novel agrochemicals. Its antimicrobial properties make it a promising candidate for the development of pesticides and fungicides, helping to protect crops from various pathogens and enhance agricultural productivity.
Used in Medicinal Chemistry Research:
2-Pyridin-3-yl-quinoline-4-carboxylic acid hydrazide is employed as a valuable compound in medicinal chemistry research for its potential applications in drug discovery. Its unique structure and bioactivity provide a foundation for the design and synthesis of new therapeutic agents, driving innovation in the development of treatments for various diseases.
Used in Drug Delivery Systems:
To enhance the therapeutic efficacy and bioavailability of 2-Pyridin-3-yl-quinoline-4-carboxylic acid hydrazide, it is incorporated into drug delivery systems. These systems, which may include nanoparticles or other carriers, aim to improve the compound's delivery to target sites, ensuring optimal pharmacological effects and minimizing side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 5109-97-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,0 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5109-97:
(6*5)+(5*1)+(4*0)+(3*9)+(2*9)+(1*7)=87
87 % 10 = 7
So 5109-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H12N4O/c16-19-15(20)12-8-14(10-4-3-7-17-9-10)18-13-6-2-1-5-11(12)13/h1-9H,16H2,(H,19,20)
