51124-29-9 Usage
Description
2,4-Diamino-6-[[p-chlorophenyl]thio]quinazoline is a quinazoline derivative with the molecular formula C16H12ClN3S. It features a substituted p-chlorophenylthio group, which may contribute to its specific binding and inhibitory properties. This chemical compound has demonstrated potential biological activity, particularly as an inhibitor of tyrosine kinase enzymes, and has been investigated for its antitumor and antitubercular capabilities, positioning it as a promising candidate for further research and development in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
2,4-Diamino-6-[[p-chlorophenyl]thio]quinazoline is used as a potential antitumor agent due to its ability to inhibit tyrosine kinase enzymes, which play a crucial role in the regulation of cell growth and proliferation. Its inhibitory action on these enzymes may help in the treatment of various types of cancer by preventing uncontrolled cell division and tumor growth.
Additionally, 2,4-Diamino-6-[[p-chlorophenyl]thio]quinazoline is used as a potential antitubercular agent. Tuberculosis is a severe infectious disease caused by the bacterium Mycobacterium tuberculosis. 2,4-Diamino-6-[[p-chlorophenyl]thio]quinazoline's potential to target and inhibit specific enzymes or pathways in the bacterium may contribute to the development of new and effective treatments for tuberculosis.
Check Digit Verification of cas no
The CAS Registry Mumber 51124-29-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,1,2 and 4 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 51124-29:
(7*5)+(6*1)+(5*1)+(4*2)+(3*4)+(2*2)+(1*9)=79
79 % 10 = 9
So 51124-29-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H11ClN4S/c15-8-1-3-9(4-2-8)20-10-5-6-12-11(7-10)13(16)19-14(17)18-12/h1-7H,(H4,16,17,18,19)
