511522-69-3 Usage
Uses
Used in Pharmaceutical Industry:
Pyridine, 2-chloro-3,5-difluoro(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique reactivity and properties make it a valuable component in the development of new drugs and medications.
Used in Agrochemical Industry:
Pyridine, 2-chloro-3,5-difluoro(9CI) is used as a building block in the production of agrochemicals, such as pesticides and herbicides. Its ability to coordinate metal ions and participate in chemical reactions allows for the creation of effective and targeted agricultural products.
Used in Chemical Reactions:
Pyridine, 2-chloro-3,5-difluoro(9CI) is used as a reactant in various chemical reactions, taking advantage of its basicity and reactivity. This allows for the synthesis of a wide range of compounds and materials with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 511522-69-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,1,1,5,2 and 2 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 511522-69:
(8*5)+(7*1)+(6*1)+(5*5)+(4*2)+(3*2)+(2*6)+(1*9)=113
113 % 10 = 3
So 511522-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H2ClF2N/c6-5-4(8)1-3(7)2-9-5/h1-2H
511522-69-3Relevant academic research and scientific papers
Hedgehog pathway modulators
-
Page/Page column 79; 80, (2016/01/09)
The invention provides a method, compounds and compositions for modulating the activity of the hedgehog signaling pathway. In particular, the invention provides a method for inhibiting aberrant growth states resulting from phenotypes such as Ptc loss-of-function, hedgehog gain-of-function, smoothened gain-of-function or Gli gain-of-function, comprising contacting a cell with a sufficient amount of a compound of Formula (I).
