51202-40-5 Usage
General Description
The chemical (5-benzyl-3-furyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethyl-cyclo propane-1-carboxylate is a compound with a complex structure. It contains a benzyl group, a furyl group, and a cyclopentylidenemethyl group. The dimethyl-cyclopropane-1-carboxylate moiety adds further complexity to the molecule. This chemical likely has varied biological and chemical properties due to its unique combination of functional groups and structural features. Its precise uses and effects would need to be studied in detail.
Check Digit Verification of cas no
The CAS Registry Mumber 51202-40-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,2,0 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 51202-40:
(7*5)+(6*1)+(5*2)+(4*0)+(3*2)+(2*4)+(1*0)=65
65 % 10 = 5
So 51202-40-5 is a valid CAS Registry Number.
InChI:InChI=1/C24H28O3/c1-24(2)21(14-18-10-6-7-11-18)22(24)23(25)27-16-19-13-20(26-15-19)12-17-8-4-3-5-9-17/h3-5,8-9,13-15,21-22H,6-7,10-12,16H2,1-2H3/t21-,22+/m1/s1