5130-16-5 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(carboxymethylsulfanyl)-4-oxo-pentanoic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its unique chemical properties and reactivity. It contributes to the development of new drugs and therapeutic agents.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 2-(carboxymethylsulfanyl)-4-oxo-pentanoic acid serves as a building block for the synthesis of complex organic compounds. Its unique functional groups allow for versatile reactions and the formation of diverse molecular structures.
Used in Industrial Processes:
2-(carboxymethylsulfanyl)-4-oxo-pentanoic acid is utilized in various industrial processes due to its chemical properties. It plays a role in the manufacturing of specialty chemicals, materials, and other products that require its specific reactivity and functional groups.
Used in Chemical Reactions:
As a reactive chemical compound, 2-(carboxymethylsulfanyl)-4-oxo-pentanoic acid is employed in a wide range of chemical reactions. Its carboxymethylsulfanyl group and other functional groups enable it to participate in various types of reactions, such as esterification, amidation, and condensation, among others.
Used in Medicinal and Biochemical Research:
Due to its potential biological and pharmacological properties, 2-(carboxymethylsulfanyl)-4-oxo-pentanoic acid is a subject of interest in medicinal and biochemical research. Scientists explore its interactions with biological systems, its potential therapeutic effects, and its role in understanding fundamental biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 5130-16-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,3 and 0 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5130-16:
(6*5)+(5*1)+(4*3)+(3*0)+(2*1)+(1*6)=55
55 % 10 = 5
So 5130-16-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O5S/c1-4(8)2-5(7(11)12)13-3-6(9)10/h5H,2-3H2,1H3,(H,9,10)(H,11,12)
