51324-37-9 Usage
Uses
Used in Pharmaceutical Industry:
2,4,5-Triamino-6-pyrimidinol dihydrochloride is used as a key intermediate for the synthesis of cyclic pyranopterin monophosphate, which is a biosynthetic intermediate used in the molybdenum pathway. This pathway plays a crucial role in the metabolism of certain enzymes and is essential for various biological processes.
In the synthesis of cyclic pyranopterin monophosphate, 2,4,5-Triamino-6-pyrimidinol dihydrochloride serves as a building block, contributing to the development of compounds that can be used in the treatment of various medical conditions related to the molybdenum pathway. Its role in the pharmaceutical industry is significant, as it aids in the production of essential compounds for human health.
Check Digit Verification of cas no
The CAS Registry Mumber 51324-37-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,3,2 and 4 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 51324-37:
(7*5)+(6*1)+(5*3)+(4*2)+(3*4)+(2*3)+(1*7)=89
89 % 10 = 9
So 51324-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H7N5O.2ClH/c5-1-2(6)8-4(7)9-3(1)10;;/h5H2,(H5,6,7,8,9,10);2*1H
