5135-54-6 Usage
Chemical structure
A pyrrole-2,5-dione derivative with a dimethylamino group attached to the third carbon of the pyrrole ring and a propyl chain.
Derivation
Derived from pyrrole-2,5-dione, a heterocyclic compound with a nitrogen atom in the ring.
Functional groups
Contains a dimethylamino group (-N(CH3)2) and a propyl chain (-CH2CH2CH3).
Reactivity
Acts as a nucleophile due to the presence of the dimethylamino group, which is an electron-donating group.
Complex formation
Forms stable complexes with various metal ions, making it useful in coordination chemistry.
Applications
Commonly used as a reagent in organic synthesis, particularly for the creation of pharmaceutical compounds and agrochemicals.
Building block
Serves as a building block for the synthesis of various heterocycles and complex organic molecules.
Biological activity
Studied for its potential biological activity, particularly in the field of medicinal chemistry.
Solubility
Soluble in polar solvents such as water, methanol, and ethanol due to the presence of the polar dimethylamino group.
Stability
Relatively stable under normal conditions, but sensitive to strong acids and bases, which can lead to hydrolysis or other degradation reactions.
Hazards
May be harmful if inhaled, ingested, or absorbed through the skin. It is important to handle 1-(3-Dimethylaminopropyl)-1H-pyrrole-2,5-dione with proper safety precautions, such as wearing gloves and using a fume hood.
Storage
Should be stored in a cool, dry place, away from light and heat, and in a sealed container to prevent degradation or contamination.
Check Digit Verification of cas no
The CAS Registry Mumber 5135-54-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,3 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5135-54:
(6*5)+(5*1)+(4*3)+(3*5)+(2*5)+(1*4)=76
76 % 10 = 6
So 5135-54-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2O2/c1-10(2)6-3-7-11-8(12)4-5-9(11)13/h4-5H,3,6-7H2,1-2H3
