51355-94-3 Usage
Uses
Used in Organic Synthesis:
6-bromo-3-pyridazinol(SALTDATA: FREE) is used as a building block in organic synthesis for the creation of various chemical compounds. Its unique structure allows for the formation of new bonds and the synthesis of complex organic molecules.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 6-bromo-3-pyridazinol(SALTDATA: FREE) serves as an intermediate in the synthesis of drugs. Its presence in the molecular structure can contribute to the development of new medications with specific therapeutic properties.
Used in Antiviral Applications:
6-bromo-3-pyridazinol(SALTDATA: FREE) is used as an antiviral agent due to its potential biological activities. It may help inhibit viral replication and reduce the severity of viral infections.
Used in Antimicrobial Applications:
6-bromo-3-pyridazinol(SALTDATA: FREE) is also utilized as an antimicrobial agent, where it can combat bacterial infections by disrupting essential cellular processes or inhibiting the growth of microorganisms.
Used in Research and Development:
6-bromo-3-pyridazinol(SALTDATA: FREE) is employed in research and development for studying its chemical properties, potential applications, and effects on biological systems. It aids scientists in understanding its role in various chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 51355-94-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,3,5 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 51355-94:
(7*5)+(6*1)+(5*3)+(4*5)+(3*5)+(2*9)+(1*4)=113
113 % 10 = 3
So 51355-94-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H3BrN2O/c5-3-1-2-4(8)7-6-3/h1-2H,(H,7,8)
51355-94-3Relevant academic research and scientific papers
PYRIDINONE DERIVATIVES AND THEIR USE AS SELECTIVE ALK-2 INHIBITORS
-
Page/Page column 111, (2019/06/11)
The invention relates to a compound of Formula I or a pharmaceutically acceptable salt thereof, a method for manufacturing the compounds of the invention, and its therapeutic uses. The present invention further provides a combination of pharmacologically active agents and a pharmaceutical composition.
