51452-52-9 Usage
Chemical class
Isoquinolines
Explanation
The compound belongs to the class of isoquinolines, which are a group of organic compounds with a bicyclic structure consisting of a benzene ring fused to a pyridine ring.
Explanation
The compound is a hydrochloride salt of a tetrahydroisoquinoline derivative, which means it has a hydrochloric acid (HCl) molecule attached to it, forming a salt.
Explanation
The isoquinoline ring in the compound has a hydroxypropyl (-CH2CH(OH)CH3) and two dimethoxy (-OCH3) substituents, which are responsible for its specific chemical properties.
Explanation
The compound has the potential to act as a neurotransmitter modulator, which means it can influence the activity of neurotransmitters in the brain, potentially leading to psychotropic effects.
Explanation
The compound is being researched for its potential use in the treatment of central nervous system disorders, which are conditions that affect the brain and spinal cord.
Explanation
The compound may have potential as a medication for substance abuse and addiction, possibly due to its ability to modulate neurotransmitter activity in the brain.
Explanation
The compound may possess analgesic (pain-relieving) and anticonvulsant (seizure-preventing) properties, making it a potentially valuable compound in the field of medicine and pharmacology.
Explanation
The compound has a bicyclic structure, with a benzene ring fused to a pyridine ring, which is characteristic of isoquinoline compounds.
Hydrochloride salt
Tetrahydroisoquinoline derivative
Substituents
Hydroxypropyl and dimethoxy groups
Potential pharmaceutical applications
Neurotransmitter modulator
Research focus
Central nervous system disorders
Potential medication
Substance abuse and addiction
Additional properties
Analgesic and anticonvulsant
Structure
Bicyclic organic compound
Check Digit Verification of cas no
The CAS Registry Mumber 51452-52-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,4,5 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 51452-52:
(7*5)+(6*1)+(5*4)+(4*5)+(3*2)+(2*5)+(1*2)=99
99 % 10 = 9
So 51452-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H21NO3/c1-17-13-8-10-5-6-15-12(4-3-7-16)11(10)9-14(13)18-2/h8-9,12,15-16H,3-7H2,1-2H3/p+1/t12-/m1/s1
51452-52-9Relevant academic research and scientific papers
Acid promoted cyclodehydration of amino alcohols with amide acetal
Hwang, Soonho,Park, Heemin,Kwon, Yongseok,Kim, Sanghee
, p. 60017 - 60024 (2015/02/19)
A convenient acid-promoted cyclization protocol for the formation of azaheterocycles from amino alcohols is described. The reaction involves the use of N,N-dimethylacetamide dimethyl acetal (DMADA) as the activating reagent of the hydroxyl group. Using this protocol, pyrrolidines or piperidines with various substituents can be synthesized in good to high yields.
