51468-00-9 Usage
Description
3-Amino-5-ethoxypyridine is a chemical compound characterized by its molecular formula C7H10N2O and a molar mass of 138.17 g/mol. It is a pyridine derivative featuring an amino group and an ethoxy group, which contribute to its versatile chemical properties. This colorless to light yellow liquid exhibits a slightly fruity odor and is soluble in polar solvents like water and alcohol. Due to its potential to cause irritation to the skin, eyes, and respiratory system, careful handling is advised.
Uses
Used in Pharmaceutical and Agrochemical Industries:
3-Amino-5-ethoxypyridine serves as a crucial intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows for the development of new compounds with specific therapeutic or pesticidal properties, enhancing the effectiveness of these products.
Used in Dye Production:
3-Amino-5-ethoxypyridine is also utilized in the production of dyes, where its chemical properties contribute to the creation of vibrant and stable colorants for various applications, including textiles, plastics, and printing inks.
Used in Organic Synthesis as a Building Block:
3-Amino-5-ethoxypyridine is employed as a building block in organic synthesis, enabling the construction of complex organic molecules with diverse applications in the chemical, pharmaceutical, and materials science industries. Its presence in these molecules can influence their reactivity, stability, and overall performance.
Check Digit Verification of cas no
The CAS Registry Mumber 51468-00-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,4,6 and 8 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 51468-00:
(7*5)+(6*1)+(5*4)+(4*6)+(3*8)+(2*0)+(1*0)=109
109 % 10 = 9
So 51468-00-9 is a valid CAS Registry Number.
InChI:InChI=1S/C7H10N2O/c1-2-10-7-3-6(8)4-9-5-7/h3-5H,2,8H2,1H3
51468-00-9Relevant articles and documents
Creating an antibacterial with in vivo efficacy: Synthesis and characterization of potent inhibitors of the bacterial cell division protein FTSZ with improved pharmaceutical properties
Haydon, David J.,Bennett, James M.,Brown, David,Collins, Ian,Galbraith, Greta,Lancett, Paul,MacDonald, Rebecca,Stokes, Neil R.,Chauhan, Pramod K.,Sutariya, Jignesh K.,Nayal, Narendra,Srivastava, Anil,Beanland, Joy,Hall, Robin,Henstock, Vincent,Noula, Caterina,Rockley, Chris,Czaplewski, Lloyd
supporting information; experimental part, p. 3927 - 3936 (2010/09/04)
3-Methoxybenzamide (1) is a weak inhibitor of the essential bacterial cell division protein FtsZ. Alkyl derivatives of 1 are potent antistaphylococcal compounds with suboptimal drug-like properties. Exploration of the structure-activity relationships of analogues of these inhibitors led to the identification of potent antistaphylococcal compounds with improved pharmaceutical properties.
