51501-31-6 Usage
Uses
Used in Pharmaceutical Industry:
1-Acetyl-7-amino-2,3-dihydro-(1H)-indole is used as a precursor in the synthesis of various pharmaceutical drugs for its potential therapeutic applications. It plays a crucial role in the development of anti-viral and anti-cancer medications, contributing to the advancement of treatments for these diseases.
Used in Organic Chemistry Research:
In the field of organic chemistry, 1-Acetyl-7-amino-2,3-dihydro-(1H)-indole serves as a building block for the creation of novel chemical compounds. Its unique structure and properties make it a valuable component in the synthesis of new molecules with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 51501-31-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,5,0 and 1 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 51501-31:
(7*5)+(6*1)+(5*5)+(4*0)+(3*1)+(2*3)+(1*1)=76
76 % 10 = 6
So 51501-31-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O/c1-7(13)12-6-5-8-3-2-4-9(11)10(8)12/h2-4H,5-6,11H2,1H3
