5165-56-0 Usage
Molecular structure
A complex structure consisting of an indole ring with a 4-methylphenyl group attached to it.
Functional groups
Contains a hydroxyl group and a carbonyl group.
Aromatic properties
Due to the presence of the indole and phenyl rings.
Ketone properties
Due to the presence of the carbonyl group.
Pharmaceutical applications
Often used in the synthesis of potential drug candidates.
Biological activities
Possesses antioxidant and anti-inflammatory properties.
Value in drug development
Its unique structure and functional groups make it a valuable building block for the development of new drugs and therapeutic agents.
Range of illnesses and conditions
Can be used for a wide range of illnesses and conditions due to its versatile structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 5165-56-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,6 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5165-56:
(6*5)+(5*1)+(4*6)+(3*5)+(2*5)+(1*6)=90
90 % 10 = 0
So 5165-56-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H17NO2/c1-11-4-6-14(7-5-11)19-12(2)18(13(3)20)16-10-15(21)8-9-17(16)19/h4-10,21H,1-3H3
