517-73-7 Usage
General Description
9(10H)-Acridinone,1,2,3,4-tetramethoxy-10-methyl- is a chemical compound with a specific molecular structure consisting of an acridinone core with four methoxy and one methyl substituents. 9(10H)-Acridinone,1,2,3,4-tetramethoxy-10-methyl- is primarily used in research and chemical synthesis as a building block and intermediate for the production of various derivatives and analogs. It has been studied for its potential pharmacological and biological properties, including its antitumor and antiviral activities. Additionally, it has shown promise as a fluorescent dye and has been investigated for its potential use in medical imaging and diagnostic applications. Overall, the compound's unique structure and diverse potential applications make it an interesting subject for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 517-73-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,1 and 7 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 517-73:
(5*5)+(4*1)+(3*7)+(2*7)+(1*3)=67
67 % 10 = 7
So 517-73-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H19NO5/c1-19-11-9-7-6-8-10(11)14(20)12-13(19)16(22-3)18(24-5)17(23-4)15(12)21-2/h6-9H,1-5H3