51730-94-0 Usage
Uses
Used in Chemical Industry:
(methyl-2-phenoxyethoxy)propanol is used as a chemical intermediate for the synthesis of various compounds due to its unique structural features.
Used in Pharmaceutical Industry:
(methyl-2-phenoxyethoxy)propanol is used as a building block in the development of new drugs, potentially contributing to the creation of novel therapeutic agents.
Used in Material Science:
(methyl-2-phenoxyethoxy)propanol is used as a component in the formulation of advanced materials, such as polymers and coatings, due to its reactive groups and compatibility with other chemical entities.
Used in Research and Development:
(methyl-2-phenoxyethoxy)propanol is used as a research compound for studying its chemical properties, reactivity, and potential interactions with other molecules, which could lead to new discoveries and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 51730-94-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,7,3 and 0 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 51730-94:
(7*5)+(6*1)+(5*7)+(4*3)+(3*0)+(2*9)+(1*4)=110
110 % 10 = 0
So 51730-94-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H18O3/c1-11(14-9-5-8-13)10-15-12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-10H2,1H3
